China (Mainland)
Premiumsupplier
C5H9NO 3-Ethoxypropionitrile 2141-62-0 CAS NO.2141-62-0 CAS NO.2141-62-0
- Min.Order: 1 Kilogram
- Payment Terms: L/C,T/T,
- Product Details
Keywords
- CAS NO.2141-62-0
- 3-Ethoxypropionitrile
- 2141-62-0
Quick Details
- ProName: C5H9NO 3-Ethoxypropionitrile 2141-62-0...
- CasNo: 2141-62-0
- Molecular Formula: C5H9NO
- Appearance: Colorless liquid
- Application: Pharmaceutical, health food
- DeliveryTime: as customers request
- PackAge: 100g/pack,1kg/pack,25kg/drum
- Port: any port in China
- ProductionCapacity: 100 Metric Ton/Month
- Purity: >99%
- Storage: Cool Dry Place
- Transportation: by sea or by air
- LimitNum: 1 Kilogram
Superiority
| 1)Quick Response Within 12 hours; |
| 2)Quality Guarantee: All products are strictly tested by our QC, confirmed by QA and approved by third party lab in China, USA, Canada, Germany, UK, Italy, France etc. |
| 3) OEM/ODM Available; |
| 4) Reasonable & Competitive Price; |
| 5) Fast Delivery: Samples from stock; bulk products within 7 days; |
| 6) Professional Documents for Your Clearance; |
| 7) Economic Freight Save Your Cost; |
| 8) All your money be refund immediately if quality issue happens. |
Details
Product information:
| 3-ethoxypropionitrile basic information | |
| product name: | 3-ethoxypropionitrile |
| synonyms: | propanenitrile,3-ethoxy-;propionitrile, 3-ethoxy-;propionitrile,3-ethoxy-;β-ethoxypropionitrile;3-ethoxypropiononitrile;3-ethoxypropionitrile (eopn);3-ethoxypropionitride;2-cyanoethyl ethyl ether |
| cas: | 2141-62-0 |
| mf: | c5h9no |
| mw: | 99.13 |
| einecs: | 218-393-4 |
| product categories: | |
| mol file: | 2141-62-0.mol |
 |
|
| 3-ethoxypropionitrile chemical properties | |
| boiling point | 171°c |
| density | 0.894 |
| refractive index | 1.4075 |
| fp | 64°c |
| brn | 741924 |
| cas database reference | 2141-62-0(cas database reference) |
| nist chemistry reference | c2h5ch(oc2h5)ch2cn(2141-62-0) |
| epa substance registry system | propanenitrile, 3-ethoxy-(2141-62-0) |
| safety information | |
| hazard codes | xi |
| risk statements | 20/21/22-36/37/38 |
| safety statements | 26-36/37/39-36-37 |
| ridadr | 3276 |
| rtecs | tz4680000 |
| tsca | yes |
| 3-ethoxypropionitrile usage and synthesis | |
| chemical properties | colorless liquid |
| 3-ethoxypropionitrile preparation products and raw materials | |
| raw materials | bromoethane |